C19H31N3O4 — CID 155719614
tert-butyl carbamate;N-cyclohexyl-5-ethyl-2-nitroaniline (PubChem CID 155719614) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is tert-butyl carbamate;N-cyclohexyl-5-ethyl-2-nitroaniline.
| Compound Name | tert-butyl carbamate;N-cyclohexyl-5-ethyl-2-nitroaniline |
|---|---|
| PubChem CID | 155719614 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | tert-butyl carbamate;N-cyclohexyl-5-ethyl-2-nitroaniline |
| SMILES | CC(C)(C)OC(N)=O.CCc1ccc([N+](=O)[O-])c(NC2CCCCC2)c1 |
| InChI | InChI=1S/C14H20N2O2.C5H11NO2/c1-2-11-8-9-14(16(17)18)13(10-11)15-12-6-4-3-5-7-12;1-5(2,3)8-4(6)7/h8-10,12,15H,2-7H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | FLCFZYRFBHYSBB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|