C12H19N3 — CID 155719641
6-butan-2-yl-[1,2,4]triazolo[4,3-a]pyridine;ethane (PubChem CID 155719641) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 6-butan-2-yl-[1,2,4]triazolo[4,3-a]pyridine;ethane.
| Compound Name | 6-butan-2-yl-[1,2,4]triazolo[4,3-a]pyridine;ethane |
|---|---|
| PubChem CID | 155719641 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 6-butan-2-yl-[1,2,4]triazolo[4,3-a]pyridine;ethane |
| SMILES | CC.CCC(C)c1ccc2nncn2c1 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-3-8(2)9-4-5-10-12-11-7-13(10)6-9;1-2/h4-8H,3H2,1-2H3;1-2H3 |
| InChIKey | DUIPTJCVTMREPC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |