C7H5N3O — CID 82417711
[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde (PubChem CID 82417711) has the molecular formula C7H5N3O and a molecular weight of 147.14 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde.
| Compound Name | [1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 82417711 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde |
| SMILES | O=Cc1ccc2nncn2c1 |
| InChI | InChI=1S/C7H5N3O/c11-4-6-1-2-7-9-8-5-10(7)3-6/h1-5H |
| InChIKey | XVILBWOMQAUNBM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|