C7H10N2O2 — CID 15572017
1-prop-2-enylpiperazine-2,3-dione (PubChem CID 15572017) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-prop-2-enylpiperazine-2,3-dione.
| Compound Name | 1-prop-2-enylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 15572017 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1-prop-2-enylpiperazine-2,3-dione |
| SMILES | C=CCN1CCNC(=O)C1=O |
| InChI | InChI=1S/C7H10N2O2/c1-2-4-9-5-3-8-6(10)7(9)11/h2H,1,3-5H2,(H,8,10) |
| InChIKey | AUJJEEPDPZAHCL-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|