C27H29Cl2N5O4 — CID 155720246
(1Z)-N-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichloro-N-(methylcarbamoyl)anilino]-2-oxoethanimidoyl cyanide;2,3-dimethylbutane (PubChem CID 155720246) has the molecular formula C27H29Cl2N5O4 and a molecular weight of 558.47 g/mol. Its IUPAC name is (1Z)-N-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichloro-N-(methylcarbamoyl)anilino]-2-oxoethanimidoyl cyanide;2,3-dimethylbutane.
| Compound Name | (1Z)-N-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichloro-N-(methylcarbamoyl)anilino]-2-oxoethanimidoyl cyanide;2,3-dimethylbutane |
|---|---|
| PubChem CID | 155720246 |
| Molecular Formula | C27H29Cl2N5O4 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | (1Z)-N-[4-[(3-acetyl-1H-indol-5-yl)oxy]-3,5-dichloro-N-(methylcarbamoyl)anilino]-2-oxoethanimidoyl cyanide;2,3-dimethylbutane |
| SMILES | CC(C)C(C)C.CNC(=O)N(/N=C(/C#N)C=O)c1cc(Cl)c(Oc2ccc3[nH]cc(C(C)=O)c3c2)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N5O4.C6H14/c1-11(30)16-9-26-19-4-3-14(7-15(16)19)32-20-17(22)5-13(6-18(20)23)28(21(31)25-2)27-12(8-24)10-29;1-5(2)6(3)4/h3-7,9-10,26H,1-2H3,(H,25,31);5-6H,1-4H3/b27-12-; |
| InChIKey | XJFWBTCYEIAPBY-JZOUQSRCSA-N |
| XLogP | 6.99 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|