C20H30F2O — CID 155720810
(7S)-1-[2-(1,1-difluoropropyl)phenyl]-7-methyldecan-3-one (PubChem CID 155720810) has the molecular formula C20H30F2O and a molecular weight of 324.46 g/mol. Its IUPAC name is (7S)-1-[2-(1,1-difluoropropyl)phenyl]-7-methyldecan-3-one.
| Compound Name | (7S)-1-[2-(1,1-difluoropropyl)phenyl]-7-methyldecan-3-one |
|---|---|
| PubChem CID | 155720810 |
| Molecular Formula | C20H30F2O |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (7S)-1-[2-(1,1-difluoropropyl)phenyl]-7-methyldecan-3-one |
| SMILES | CCC[C@H](C)CCCC(=O)CCc1ccccc1C(F)(F)CC |
| InChI | InChI=1S/C20H30F2O/c1-4-9-16(3)10-8-12-18(23)15-14-17-11-6-7-13-19(17)20(21,22)5-2/h6-7,11,13,16H,4-5,8-10,12,14-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | WEHIKDFJQUPCAE-INIZCTEOSA-N |
| XLogP | 6.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |