C19H19N7O2S — CID 155721827
N-methyl-4-[(2,5,9-trimethyl-8-oxo-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-13-yl)amino]benzamide (PubChem CID 155721827) has the molecular formula C19H19N7O2S and a molecular weight of 409.48 g/mol. Its IUPAC name is N-methyl-4-[(2,5,9-trimethyl-8-oxo-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-13-yl)amino]benzamide.
| Compound Name | N-methyl-4-[(2,5,9-trimethyl-8-oxo-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-13-yl)amino]benzamide |
|---|---|
| PubChem CID | 155721827 |
| Molecular Formula | C19H19N7O2S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-methyl-4-[(2,5,9-trimethyl-8-oxo-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-13-yl)amino]benzamide |
| SMILES | CNC(=O)c1ccc(Nc2ncc3c(n2)N(C)c2sc(C)nc2C(=O)N3C)cc1 |
| InChI | InChI=1S/C19H19N7O2S/c1-10-22-14-17(28)25(3)13-9-21-19(24-15(13)26(4)18(14)29-10)23-12-7-5-11(6-8-12)16(27)20-2/h5-9H,1-4H3,(H,20,27)(H,21,23,24) |
| InChIKey | AYUHHYUXPCKSKU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |