C11H11Cl2F4NO — CID 15572232
2-(4-amino-3,5-dimethylphenyl)-1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ol (PubChem CID 15572232) has the molecular formula C11H11Cl2F4NO and a molecular weight of 320.11 g/mol. Its IUPAC name is 2-(4-amino-3,5-dimethylphenyl)-1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ol.
| Compound Name | 2-(4-amino-3,5-dimethylphenyl)-1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ol |
|---|---|
| PubChem CID | 15572232 |
| Molecular Formula | C11H11Cl2F4NO |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-(4-amino-3,5-dimethylphenyl)-1,3-dichloro-1,1,3,3-tetrafluoropropan-2-ol |
| SMILES | Cc1cc(C(O)(C(F)(F)Cl)C(F)(F)Cl)cc(C)c1N |
| InChI | InChI=1S/C11H11Cl2F4NO/c1-5-3-7(4-6(2)8(5)18)9(19,10(12,14)15)11(13,16)17/h3-4,19H,18H2,1-2H3 |
| InChIKey | UWKZHUYURXRYCA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|