C13H25N3 — CID 155722355
(1E)-3-methyl-1-N-(1-propylpiperidin-4-yl)buta-1,3-diene-1,2-diamine (PubChem CID 155722355) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is (1E)-3-methyl-1-N-(1-propylpiperidin-4-yl)buta-1,3-diene-1,2-diamine.
| Compound Name | (1E)-3-methyl-1-N-(1-propylpiperidin-4-yl)buta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 155722355 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | (1E)-3-methyl-1-N-(1-propylpiperidin-4-yl)buta-1,3-diene-1,2-diamine |
| SMILES | C=C(C)/C(N)=C\NC1CCN(CCC)CC1 |
| InChI | InChI=1S/C13H25N3/c1-4-7-16-8-5-12(6-9-16)15-10-13(14)11(2)3/h10,12,15H,2,4-9,14H2,1,3H3/b13-10+ |
| InChIKey | HAPRJTVTUSHISY-JLHYYAGUSA-N |
| XLogP | 1.83 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|