C15H25F3N2 — CID 144862403
(E)-4,4,4-trifluoro-3-methyl-2-(1-piperidin-1-ylethenyl)-N-propan-2-ylbut-2-en-1-amine (PubChem CID 144862403) has the molecular formula C15H25F3N2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-methyl-2-(1-piperidin-1-ylethenyl)-N-propan-2-ylbut-2-en-1-amine.
| Compound Name | (E)-4,4,4-trifluoro-3-methyl-2-(1-piperidin-1-ylethenyl)-N-propan-2-ylbut-2-en-1-amine |
|---|---|
| PubChem CID | 144862403 |
| Molecular Formula | C15H25F3N2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-methyl-2-(1-piperidin-1-ylethenyl)-N-propan-2-ylbut-2-en-1-amine |
| SMILES | C=C(/C(CNC(C)C)=C(\C)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C15H25F3N2/c1-11(2)19-10-14(12(3)15(16,17)18)13(4)20-8-6-5-7-9-20/h11,19H,4-10H2,1-3H3/b14-12+ |
| InChIKey | GUDDYZZYVTZPAR-WYMLVPIESA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|