C14H25N3 — CID 143911369
(2E,4E)-2-ethenyl-1-N-(1-methylpiperidin-4-yl)hexa-2,4-diene-1,5-diamine (PubChem CID 143911369) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-1-N-(1-methylpiperidin-4-yl)hexa-2,4-diene-1,5-diamine.
| Compound Name | (2E,4E)-2-ethenyl-1-N-(1-methylpiperidin-4-yl)hexa-2,4-diene-1,5-diamine |
|---|---|
| PubChem CID | 143911369 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (2E,4E)-2-ethenyl-1-N-(1-methylpiperidin-4-yl)hexa-2,4-diene-1,5-diamine |
| SMILES | C=C/C(=C\C=C(/C)N)CNC1CCN(C)CC1 |
| InChI | InChI=1S/C14H25N3/c1-4-13(6-5-12(2)15)11-16-14-7-9-17(3)10-8-14/h4-6,14,16H,1,7-11,15H2,2-3H3/b12-5+,13-6+ |
| InChIKey | PWIRBSSIEFFPNL-BYDSPXIWSA-N |
| XLogP | 1.65 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|