C13H24N2 — CID 143112157
3-methyl-N-(3-piperidin-1-ylpropyl)buta-1,3-dien-2-amine (PubChem CID 143112157) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 3-methyl-N-(3-piperidin-1-ylpropyl)buta-1,3-dien-2-amine.
| Compound Name | 3-methyl-N-(3-piperidin-1-ylpropyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143112157 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3-methyl-N-(3-piperidin-1-ylpropyl)buta-1,3-dien-2-amine |
| SMILES | C=C(C)C(=C)NCCCN1CCCCC1 |
| InChI | InChI=1S/C13H24N2/c1-12(2)13(3)14-8-7-11-15-9-5-4-6-10-15/h14H,1,3-11H2,2H3 |
| InChIKey | KMYZIWJMTLYIPM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|