C18H28N2 — CID 130178455
1-(3-methylbuta-1,3-dien-2-yl)-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]piperidin-4-amine (PubChem CID 130178455) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-(3-methylbuta-1,3-dien-2-yl)-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]piperidin-4-amine.
| Compound Name | 1-(3-methylbuta-1,3-dien-2-yl)-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 130178455 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-(3-methylbuta-1,3-dien-2-yl)-N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]piperidin-4-amine |
| SMILES | C=C/C(C)=C\C(=C/C)NC1CCN(C(=C)C(=C)C)CC1 |
| InChI | InChI=1S/C18H28N2/c1-7-15(5)13-17(8-2)19-18-9-11-20(12-10-18)16(6)14(3)4/h7-8,13,18-19H,1,3,6,9-12H2,2,4-5H3/b15-13-,17-8+ |
| InChIKey | LRHCSXYEYRRFQR-LDYCDDIBSA-N |
| XLogP | 4.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|