C14H24N4 — CID 143564646
1-N-methyl-1-N'-[1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]piperidin-4-yl]ethene-1,1-diamine (PubChem CID 143564646) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-N-methyl-1-N'-[1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]piperidin-4-yl]ethene-1,1-diamine.
| Compound Name | 1-N-methyl-1-N'-[1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]piperidin-4-yl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 143564646 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-N-methyl-1-N'-[1-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]piperidin-4-yl]ethene-1,1-diamine |
| SMILES | C=N/C(=C\C=C/C)N1CCC(NC(=C)NC)CC1 |
| InChI | InChI=1S/C14H24N4/c1-5-6-7-14(16-4)18-10-8-13(9-11-18)17-12(2)15-3/h5-7,13,15,17H,2,4,8-11H2,1,3H3/b6-5-,14-7+ |
| InChIKey | FEOAOGXQFNHENA-NTBKVEBNSA-N |
| XLogP | 1.85 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|