C14H24N4O2 — CID 142456979
tert-butyl N-[1-(N'-ethenyl-N-methylidenecarbamimidoyl)piperidin-4-yl]carbamate (PubChem CID 142456979) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl N-[1-(N'-ethenyl-N-methylidenecarbamimidoyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(N'-ethenyl-N-methylidenecarbamimidoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142456979 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | tert-butyl N-[1-(N'-ethenyl-N-methylidenecarbamimidoyl)piperidin-4-yl]carbamate |
| SMILES | C=C/N=C(\N=C)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H24N4O2/c1-6-16-12(15-5)18-9-7-11(8-10-18)17-13(19)20-14(2,3)4/h6,11H,1,5,7-10H2,2-4H3,(H,17,19)/b16-12+ |
| InChIKey | FFXZSVXHNVWPTI-FOWTUZBSSA-N |
| XLogP | 2.18 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|