C16H30N4O2 — CID 174043427
tert-butyl N-[1-(N-butylidene-N'-methylcarbamimidoyl)piperidin-4-yl]carbamate (PubChem CID 174043427) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[1-(N-butylidene-N'-methylcarbamimidoyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(N-butylidene-N'-methylcarbamimidoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 174043427 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[1-(N-butylidene-N'-methylcarbamimidoyl)piperidin-4-yl]carbamate |
| SMILES | CCCC=N/C(=N\C)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N4O2/c1-6-7-10-18-14(17-5)20-11-8-13(9-12-20)19-15(21)22-16(2,3)4/h10,13H,6-9,11-12H2,1-5H3,(H,19,21)/b17-14+,18-10? |
| InChIKey | BNOUUCHKOZPLCH-MBNKRCRXSA-N |
| XLogP | 2.83 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|