C17H28FN3O2 — CID 121429866
tert-butyl N-[1-[C-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N-methylcarbonimidoyl]piperidin-4-yl]carbamate (PubChem CID 121429866) has the molecular formula C17H28FN3O2 and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl N-[1-[C-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N-methylcarbonimidoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[C-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N-methylcarbonimidoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 121429866 |
| Molecular Formula | C17H28FN3O2 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | tert-butyl N-[1-[C-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N-methylcarbonimidoyl]piperidin-4-yl]carbamate |
| SMILES | C=C(F)/C=C(C)/C(=N\C)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H28FN3O2/c1-12(11-13(2)18)15(19-6)21-9-7-14(8-10-21)20-16(22)23-17(3,4)5/h11,14H,2,7-10H2,1,3-6H3,(H,20,22)/b12-11+,19-15+ |
| InChIKey | TWUQWAKLOLGHJW-IHFZGXTKSA-N |
| XLogP | 3.43 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|