C14H26N2 — CID 123149322
2-ethenyl-3-piperidin-1-yl-N-propan-2-ylbut-2-en-1-amine (PubChem CID 123149322) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-ethenyl-3-piperidin-1-yl-N-propan-2-ylbut-2-en-1-amine.
| Compound Name | 2-ethenyl-3-piperidin-1-yl-N-propan-2-ylbut-2-en-1-amine |
|---|---|
| PubChem CID | 123149322 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-ethenyl-3-piperidin-1-yl-N-propan-2-ylbut-2-en-1-amine |
| SMILES | C=CC(CNC(C)C)=C(C)N1CCCCC1 |
| InChI | InChI=1S/C14H26N2/c1-5-14(11-15-12(2)3)13(4)16-9-7-6-8-10-16/h5,12,15H,1,6-11H2,2-4H3 |
| InChIKey | LUSIOWIRHCSBNQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|