C14H17NO2 — CID 155722402
(3Z)-4-(2-methylprop-1-enylimino)-3-propylidenecyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 155722402) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (3Z)-4-(2-methylprop-1-enylimino)-3-propylidenecyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | (3Z)-4-(2-methylprop-1-enylimino)-3-propylidenecyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 155722402 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (3Z)-4-(2-methylprop-1-enylimino)-3-propylidenecyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC/C=C1/C=C(C(=O)O)C=C/C1=N\C=C(C)C |
| InChI | InChI=1S/C14H17NO2/c1-4-5-11-8-12(14(16)17)6-7-13(11)15-9-10(2)3/h5-9H,4H2,1-3H3,(H,16,17)/b11-5-,15-13+ |
| InChIKey | NWCFJXHSMRIQRL-JSYAVDNYSA-N |
| XLogP | 3.27 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|