C15H20FNO2 — CID 144627779
(E)-3-[[(3E,5E)-3-ethenyl-5-fluorohepta-3,5-dien-2-ylidene]amino]-2-methylpent-2-enoic acid (PubChem CID 144627779) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is (E)-3-[[(3E,5E)-3-ethenyl-5-fluorohepta-3,5-dien-2-ylidene]amino]-2-methylpent-2-enoic acid.
| Compound Name | (E)-3-[[(3E,5E)-3-ethenyl-5-fluorohepta-3,5-dien-2-ylidene]amino]-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 144627779 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (E)-3-[[(3E,5E)-3-ethenyl-5-fluorohepta-3,5-dien-2-ylidene]amino]-2-methylpent-2-enoic acid |
| SMILES | C=CC(=C\C(F)=C/C)/C(C)=N\C(CC)=C(/C)C(=O)O |
| InChI | InChI=1S/C15H20FNO2/c1-6-12(9-13(16)7-2)11(5)17-14(8-3)10(4)15(18)19/h6-7,9H,1,8H2,2-5H3,(H,18,19)/b12-9+,13-7+,14-10+,17-11+ |
| InChIKey | MWIOQAJEUTVLBJ-BZLYRLRPSA-N |
| XLogP | 4.20 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|