C30H34N6O3 — CID 155722970
N-(3-hydroxycyclobutyl)-4-[7-methyl-4-(methylamino)-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]benzamide;2-methylprop-2-enal (PubChem CID 155722970) has the molecular formula C30H34N6O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is N-(3-hydroxycyclobutyl)-4-[7-methyl-4-(methylamino)-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]benzamide;2-methylprop-2-enal.
| Compound Name | N-(3-hydroxycyclobutyl)-4-[7-methyl-4-(methylamino)-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]benzamide;2-methylprop-2-enal |
|---|---|
| PubChem CID | 155722970 |
| Molecular Formula | C30H34N6O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | N-(3-hydroxycyclobutyl)-4-[7-methyl-4-(methylamino)-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]benzamide;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CNc1ccc(-c2c(-c3ccc(C(=O)NC4CC(O)C4)cc3)c3c(NC)ncnc3n2C)cc1 |
| InChI | InChI=1S/C26H28N6O2.C4H6O/c1-27-18-10-8-16(9-11-18)23-21(22-24(28-2)29-14-30-25(22)32(23)3)15-4-6-17(7-5-15)26(34)31-19-12-20(33)13-19;1-4(2)3-5/h4-11,14,19-20,27,33H,12-13H2,1-3H3,(H,31,34)(H,28,29,30);3H,1H2,2H3 |
| InChIKey | VLZYEXSZSMAIBR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|