C18H11BBrNO7 — CID 155723310
CID 155723310 (PubChem CID 155723310) has the molecular formula C18H11BBrNO7 and a molecular weight of 444.00 g/mol.
| Compound Name | CID 155723310 |
|---|---|
| PubChem CID | 155723310 |
| Molecular Formula | C18H11BBrNO7 |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)c(O)c(O)c2c(C(=O)c3cc(Br)c(O)c(C#N)c3)c(C(C)O)oc12 |
| InChI | InChI=1S/C18H11BBrNO7/c1-5(22)17-9(10-14(25)16(27)15(26)11(19)18(10)28-17)13(24)6-2-7(4-21)12(23)8(20)3-6/h2-3,5,22-23,25-27H,1H3 |
| InChIKey | ZMHYGBCDHSIXTK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|