C5H8Cl2N4S — CID 15572355
2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride (PubChem CID 15572355) has the molecular formula C5H8Cl2N4S and a molecular weight of 227.12 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 15572355 |
| Molecular Formula | C5H8Cl2N4S |
| Molecular Weight | 227.12 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C5H7ClN4S.ClH/c6-1-3-2-11-5(9-3)10-4(7)8;/h2H,1H2,(H4,7,8,9,10);1H |
| InChIKey | HPXWWLGOFMSKHV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.12 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|