C14H21N2O4+ — CID 155723685
methyl (Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-eneperoxoate (PubChem CID 155723685) has the molecular formula C14H21N2O4+ and a molecular weight of 281.33 g/mol. Its IUPAC name is methyl (Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-eneperoxoate.
| Compound Name | methyl (Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-eneperoxoate |
|---|---|
| PubChem CID | 155723685 |
| Molecular Formula | C14H21N2O4+ |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | methyl (Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-eneperoxoate |
| SMILES | COOC(=O)/C=C\C(=O)[N+]12CCCCCC1=NCCC2 |
| InChI | InChI=1S/C14H21N2O4/c1-19-20-14(18)8-7-13(17)16-10-4-2-3-6-12(16)15-9-5-11-16/h7-8H,2-6,9-11H2,1H3/q+1/b8-7- |
| InChIKey | KFIWXRRKORCAFS-FPLPWBNLSA-N |
| XLogP | 1.37 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|