C13H19N2O3+ — CID 155288057
(Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-enoic acid (PubChem CID 155288057) has the molecular formula C13H19N2O3+ and a molecular weight of 251.31 g/mol. Its IUPAC name is (Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 155288057 |
| Molecular Formula | C13H19N2O3+ |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (Z)-4-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-5-yl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)[N+]12CCCCCC1=NCCC2 |
| InChI | InChI=1S/C13H18N2O3/c16-12(6-7-13(17)18)15-9-3-1-2-5-11(15)14-8-4-10-15/h6-7H,1-5,8-10H2/p+1/b7-6- |
| InChIKey | SGLJZRRDLFDJAX-SREVYHEPSA-O |
| XLogP | 1.35 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|