C13H20N2O4 — CID 172862363
(E)-but-2-enedioic acid;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine (PubChem CID 172862363) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine.
| Compound Name | (E)-but-2-enedioic acid;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 172862363 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (E)-but-2-enedioic acid;2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine |
| SMILES | C1CCC2=NCCCN2CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H16N2.C4H4O4/c1-2-5-9-10-6-4-8-11(9)7-3-1;5-3(6)1-2-4(7)8/h1-8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZNIAGNGXYOHDLH-WLHGVMLRSA-N |
| XLogP | 1.38 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|