C22H25ClFNO4 — CID 155725099
4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-1-ethylpiperidine;formic acid (PubChem CID 155725099) has the molecular formula C22H25ClFNO4 and a molecular weight of 421.90 g/mol. Its IUPAC name is 4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-1-ethylpiperidine;formic acid.
| Compound Name | 4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-1-ethylpiperidine;formic acid |
|---|---|
| PubChem CID | 155725099 |
| Molecular Formula | C22H25ClFNO4 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-1-ethylpiperidine;formic acid |
| SMILES | CCN1CCC(c2cccc3c2OC(C)(c2ccc(Cl)cc2F)O3)CC1.O=CO |
| InChI | InChI=1S/C21H23ClFNO2.CH2O2/c1-3-24-11-9-14(10-12-24)16-5-4-6-19-20(16)26-21(2,25-19)17-8-7-15(22)13-18(17)23;2-1-3/h4-8,13-14H,3,9-12H2,1-2H3;1H,(H,2,3) |
| InChIKey | QOFRNUNLQOVGNQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|