C27H28ClFN4O3 — CID 168875155
6-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-N'-hydroxy-5-methylpyridine-2-carboximidamide (PubChem CID 168875155) has the molecular formula C27H28ClFN4O3 and a molecular weight of 511.00 g/mol. Its IUPAC name is 6-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-N'-hydroxy-5-methylpyridine-2-carboximidamide.
| Compound Name | 6-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-N'-hydroxy-5-methylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 168875155 |
| Molecular Formula | C27H28ClFN4O3 |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 6-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-N'-hydroxy-5-methylpyridine-2-carboximidamide |
| SMILES | Cc1ccc(C(N)=NO)nc1CN1CCC(c2cccc3c2OC(C)(c2ccc(Cl)cc2F)O3)CC1 |
| InChI | InChI=1S/C27H28ClFN4O3/c1-16-6-9-22(26(30)32-34)31-23(16)15-33-12-10-17(11-13-33)19-4-3-5-24-25(19)36-27(2,35-24)20-8-7-18(28)14-21(20)29/h3-9,14,17,34H,10-13,15H2,1-2H3,(H2,30,32) |
| InChIKey | ROKOMNNRDZMQRH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|