C32H32ClF2N5O4 — CID 167010098
2-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide (PubChem CID 167010098) has the molecular formula C32H32ClF2N5O4 and a molecular weight of 624.09 g/mol. Its IUPAC name is 2-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide.
| Compound Name | 2-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 167010098 |
| Molecular Formula | C32H32ClF2N5O4 |
| Molecular Weight | 624.09 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 2-[[4-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-6-fluoro-N'-hydroxy-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboximidamide |
| SMILES | CC1(c2ccc(Cl)cc2F)Oc2cccc(C3CCN(Cc4nc5cc(/C(N)=N/O)c(F)cc5n4C[C@@H]4CCO4)CC3)c2O1 |
| InChI | InChI=1S/C32H32ClF2N5O4/c1-32(23-6-5-19(33)13-25(23)35)43-28-4-2-3-21(30(28)44-32)18-7-10-39(11-8-18)17-29-37-26-14-22(31(36)38-41)24(34)15-27(26)40(29)16-20-9-12-42-20/h2-6,13-15,18,20,41H,7-12,16-17H2,1H3,(H2,36,38)/t20-,32?/m0/s1 |
| InChIKey | PPWPGBPVDPRMLJ-QIFAOCFZSA-N |
| XLogP | 5.88 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.09 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|