C31H38FN6O4 — CID 155726521
CID 155726521 (PubChem CID 155726521) has the molecular formula C31H38FN6O4 and a molecular weight of 577.68 g/mol.
| Compound Name | CID 155726521 |
|---|---|
| PubChem CID | 155726521 |
| Molecular Formula | C31H38FN6O4 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCN([C]2N=C(OCC3CCCN3C)N=C3C(=O)[C@H](Oc4cc(F)ccc4CC)CCC23)CC1CC#N |
| InChI | InChI=1S/C31H38FN6O4/c1-4-20-8-9-21(32)17-26(20)42-25-11-10-24-28(29(25)40)34-31(41-19-23-7-6-14-36(23)3)35-30(24)37-15-16-38(27(39)5-2)22(18-37)12-13-33/h5,8-9,17,22-25H,2,4,6-7,10-12,14-16,18-19H2,1,3H3/t22?,23?,24?,25-/m1/s1 |
| InChIKey | ULAKPSJSLAZWRS-FVPXYTCKSA-N |
| XLogP | 3.14 |
| TPSA | 110.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|