C32H43N6O2S — CID 155726561
CID 155726561 (PubChem CID 155726561) has the molecular formula C32H43N6O2S and a molecular weight of 575.80 g/mol.
| Compound Name | CID 155726561 |
|---|---|
| PubChem CID | 155726561 |
| Molecular Formula | C32H43N6O2S |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCN(C2=NC(OCC3CCCN3C)=NC(C)[C]2CC[C@H]2CCc3cc(C)ccc3S2)CC1CC#N |
| InChI | InChI=1S/C32H43N6O2S/c1-5-30(39)38-18-17-37(20-25(38)14-15-33)31-28(12-11-27-10-9-24-19-22(2)8-13-29(24)41-27)23(3)34-32(35-31)40-21-26-7-6-16-36(26)4/h5,8,13,19,23,25-27H,1,6-7,9-12,14,16-18,20-21H2,2-4H3/t23?,25?,26?,27-/m1/s1 |
| InChIKey | LRYUCTUWIRAWTI-OVBKJGQJSA-N |
| XLogP | 4.64 |
| TPSA | 84.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|