C30H36FN6O4 — CID 155726594
CID 155726594 (PubChem CID 155726594) has the molecular formula C30H36FN6O4 and a molecular weight of 563.65 g/mol.
| Compound Name | CID 155726594 |
|---|---|
| PubChem CID | 155726594 |
| Molecular Formula | C30H36FN6O4 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC3CCCN3C)nc(C=O)c2CC[C@@H]2OC3C=C[CH]C=C3C2F)CC1CC#N |
| InChI | InChI=1S/C30H36FN6O4/c1-3-27(39)37-16-15-36(17-20(37)12-13-32)29-22(10-11-26-28(31)23-8-4-5-9-25(23)41-26)24(18-38)33-30(34-29)40-19-21-7-6-14-35(21)2/h3-5,8-9,18,20-21,25-26,28H,1,6-7,10-12,14-17,19H2,2H3/t20?,21?,25?,26-,28?/m0/s1 |
| InChIKey | BQHCRGHLDKTWIL-IIKIVHCDSA-N |
| XLogP | 2.62 |
| TPSA | 111.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|