C32H43N6O3 — CID 155726638
CID 155726638 (PubChem CID 155726638) has the molecular formula C32H43N6O3 and a molecular weight of 559.74 g/mol.
| Compound Name | CID 155726638 |
|---|---|
| PubChem CID | 155726638 |
| Molecular Formula | C32H43N6O3 |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC3CCCN3C)nc(C)c2CC[C@H]2OCC3=CC=CC[C]3C2C)CC1CC#N |
| InChI | InChI=1S/C32H43N6O3/c1-5-30(39)38-18-17-37(19-25(38)14-15-33)31-28(12-13-29-22(2)27-11-7-6-9-24(27)20-40-29)23(3)34-32(35-31)41-21-26-10-8-16-36(26)4/h5-7,9,22,25-26,29H,1,8,10-14,16-21H2,2-4H3/t22?,25?,26?,29-/m1/s1 |
| InChIKey | ZNSDBBRIBOKMFY-CGNOTVKESA-N |
| XLogP | 3.80 |
| TPSA | 94.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|