C21H31N5O2 — CID 146478381
2-[(2S)-4-(5-ethyl-6-methyl-2-pentoxypyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 146478381) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[(2S)-4-(5-ethyl-6-methyl-2-pentoxypyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-(5-ethyl-6-methyl-2-pentoxypyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 146478381 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 2-[(2S)-4-(5-ethyl-6-methyl-2-pentoxypyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2nc(OCCCCC)nc(C)c2CC)C[C@@H]1CC#N |
| InChI | InChI=1S/C21H31N5O2/c1-5-8-9-14-28-21-23-16(4)18(6-2)20(24-21)25-12-13-26(19(27)7-3)17(15-25)10-11-22/h7,17H,3,5-6,8-10,12-15H2,1-2,4H3/t17-/m0/s1 |
| InChIKey | IPCMMAYBXYUSCV-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|