C18H25N5O2 — CID 146478371
2-[4-(2-ethoxy-5-ethyl-6-methylpyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 146478371) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[4-(2-ethoxy-5-ethyl-6-methylpyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-(2-ethoxy-5-ethyl-6-methylpyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 146478371 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-[4-(2-ethoxy-5-ethyl-6-methylpyrimidin-4-yl)-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC)nc(C)c2CC)CC1CC#N |
| InChI | InChI=1S/C18H25N5O2/c1-5-15-13(4)20-18(25-7-3)21-17(15)22-10-11-23(16(24)6-2)14(12-22)8-9-19/h6,14H,2,5,7-8,10-12H2,1,3-4H3 |
| InChIKey | PIGVQTQTYLPXSV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|