C20H36O — CID 155727846
(E)-11,11,15,15-tetramethylhexadec-6-en-1-yn-3-ol (PubChem CID 155727846) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (E)-11,11,15,15-tetramethylhexadec-6-en-1-yn-3-ol.
| Compound Name | (E)-11,11,15,15-tetramethylhexadec-6-en-1-yn-3-ol |
|---|---|
| PubChem CID | 155727846 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (E)-11,11,15,15-tetramethylhexadec-6-en-1-yn-3-ol |
| SMILES | C#CC(O)CC/C=C/CCCC(C)(C)CCCC(C)(C)C |
| InChI | InChI=1S/C20H36O/c1-7-18(21)14-11-9-8-10-12-16-20(5,6)17-13-15-19(2,3)4/h1,8-9,18,21H,10-17H2,2-6H3/b9-8+ |
| InChIKey | DQCHHRKMSLVYCJ-CMDGGOBGSA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|