C18H22N6OS — CID 155728957
3-[[6-(5-methyl-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-4-yl]amino]but-1-en-2-ol;propan-2-imine (PubChem CID 155728957) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 3-[[6-(5-methyl-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-4-yl]amino]but-1-en-2-ol;propan-2-imine.
| Compound Name | 3-[[6-(5-methyl-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-4-yl]amino]but-1-en-2-ol;propan-2-imine |
|---|---|
| PubChem CID | 155728957 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[[6-(5-methyl-1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidin-4-yl]amino]but-1-en-2-ol;propan-2-imine |
| SMILES | C=C(O)C(C)Nc1ncnc2ncc(-c3ncc(C)s3)cc12.[H]N=C(C)C |
| InChI | InChI=1S/C15H15N5OS.C3H7N/c1-8-5-17-15(22-8)11-4-12-13(16-6-11)18-7-19-14(12)20-9(2)10(3)21;1-3(2)4/h4-7,9,21H,3H2,1-2H3,(H,16,18,19,20);4H,1-2H3 |
| InChIKey | OQQRFGHIMVZTQI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|