C14H16F4N2O2 — CID 155729290
1-[(E,2Z)-2-(1-fluoroethylidene)-3-(trifluoromethyl)hex-3-enyl]-6-methylpyrimidine-2,4-dione (PubChem CID 155729290) has the molecular formula C14H16F4N2O2 and a molecular weight of 320.29 g/mol. Its IUPAC name is 1-[(E,2Z)-2-(1-fluoroethylidene)-3-(trifluoromethyl)hex-3-enyl]-6-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(E,2Z)-2-(1-fluoroethylidene)-3-(trifluoromethyl)hex-3-enyl]-6-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155729290 |
| Molecular Formula | C14H16F4N2O2 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-[(E,2Z)-2-(1-fluoroethylidene)-3-(trifluoromethyl)hex-3-enyl]-6-methylpyrimidine-2,4-dione |
| SMILES | CC/C=C(C(\Cn1c(C)cc(=O)[nH]c1=O)=C(/C)F)/C(F)(F)F |
| InChI | InChI=1S/C14H16F4N2O2/c1-4-5-11(14(16,17)18)10(9(3)15)7-20-8(2)6-12(21)19-13(20)22/h5-6H,4,7H2,1-3H3,(H,19,21,22)/b10-9+,11-5+ |
| InChIKey | GOYHYXRTOBBUHW-PNGXCIJNSA-N |
| XLogP | 2.99 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|