C14H16F4N2O2 — CID 155699504
(Z)-3-[[2-fluoro-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl-formylamino]-N-methylbut-2-enamide (PubChem CID 155699504) has the molecular formula C14H16F4N2O2 and a molecular weight of 320.29 g/mol. Its IUPAC name is (Z)-3-[[2-fluoro-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl-formylamino]-N-methylbut-2-enamide.
| Compound Name | (Z)-3-[[2-fluoro-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl-formylamino]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 155699504 |
| Molecular Formula | C14H16F4N2O2 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (Z)-3-[[2-fluoro-6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl-formylamino]-N-methylbut-2-enamide |
| SMILES | CNC(=O)/C=C(/C)N(C=O)CC1=C(F)CCC=C1C(F)(F)F |
| InChI | InChI=1S/C14H16F4N2O2/c1-9(6-13(22)19-2)20(8-21)7-10-11(14(16,17)18)4-3-5-12(10)15/h4,6,8H,3,5,7H2,1-2H3,(H,19,22)/b9-6- |
| InChIKey | UEVSTVVESSFDPJ-TWGQIWQCSA-N |
| XLogP | 2.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|