C13H18F3N3O2 — CID 153398096
N-(1,4-dimethyl-6-oxo-3-pyridinyl)formamide;3-(trifluoromethyl)pyrrolidine (PubChem CID 153398096) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-(1,4-dimethyl-6-oxo-3-pyridinyl)formamide;3-(trifluoromethyl)pyrrolidine.
| Compound Name | N-(1,4-dimethyl-6-oxo-3-pyridinyl)formamide;3-(trifluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 153398096 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-(1,4-dimethyl-6-oxo-3-pyridinyl)formamide;3-(trifluoromethyl)pyrrolidine |
| SMILES | Cc1cc(=O)n(C)cc1NC=O.FC(F)(F)C1CCNC1 |
| InChI | InChI=1S/C8H10N2O2.C5H8F3N/c1-6-3-8(12)10(2)4-7(6)9-5-11;6-5(7,8)4-1-2-9-3-4/h3-5H,1-2H3,(H,9,11);4,9H,1-3H2 |
| InChIKey | OKRQFNWTOQEXBD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|