C12H16F3N3O2 — CID 153398195
N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide;pyrrolidine (PubChem CID 153398195) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide;pyrrolidine.
| Compound Name | N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide;pyrrolidine |
|---|---|
| PubChem CID | 153398195 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide;pyrrolidine |
| SMILES | C1CCNC1.O=CNc1cc(F)c(=O)n(CC(F)F)c1 |
| InChI | InChI=1S/C8H7F3N2O2.C4H9N/c9-6-1-5(12-4-14)2-13(8(6)15)3-7(10)11;1-2-4-5-3-1/h1-2,4,7H,3H2,(H,12,14);5H,1-4H2 |
| InChIKey | ROWRXSGCHXDKLS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|