C8H7F3N2O2 — CID 153397925
N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide (PubChem CID 153397925) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide.
| Compound Name | N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 153397925 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)-5-fluoro-6-oxo-3-pyridinyl]formamide |
| SMILES | O=CNc1cc(F)c(=O)n(CC(F)F)c1 |
| InChI | InChI=1S/C8H7F3N2O2/c9-6-1-5(12-4-14)2-13(8(6)15)3-7(10)11/h1-2,4,7H,3H2,(H,12,14) |
| InChIKey | CWTCFPNASJFDJN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|