C15H20F7N3O2 — CID 158228991
6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide;propan-1-amine (PubChem CID 158228991) has the molecular formula C15H20F7N3O2 and a molecular weight of 407.33 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide;propan-1-amine.
| Compound Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide;propan-1-amine |
|---|---|
| PubChem CID | 158228991 |
| Molecular Formula | C15H20F7N3O2 |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide;propan-1-amine |
| SMILES | CCCN.CCCNC(=O)c1ccc(C(F)(F)C(F)(F)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C12H11F7N2O2.C3H9N/c1-2-5-20-8(22)6-3-4-7(21-9(6)23)10(13,14)11(15,16)12(17,18)19;1-2-3-4/h3-4H,2,5H2,1H3,(H,20,22)(H,21,23);2-4H2,1H3 |
| InChIKey | GEDOLHVELXYQTG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|