C10H9ClF4N2O2 — CID 59828235
6-(2-chloro-1,1,2,2-tetrafluoroethyl)-N-ethyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 59828235) has the molecular formula C10H9ClF4N2O2 and a molecular weight of 300.64 g/mol. Its IUPAC name is 6-(2-chloro-1,1,2,2-tetrafluoroethyl)-N-ethyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-(2-chloro-1,1,2,2-tetrafluoroethyl)-N-ethyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59828235 |
| Molecular Formula | C10H9ClF4N2O2 |
| Molecular Weight | 300.64 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 6-(2-chloro-1,1,2,2-tetrafluoroethyl)-N-ethyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCNC(=O)c1ccc(C(F)(F)C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C10H9ClF4N2O2/c1-2-16-7(18)5-3-4-6(17-8(5)19)9(12,13)10(11,14)15/h3-4H,2H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | VKXFKWMSULKQEP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.64 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|