C13H12ClF7N2O2 — CID 59828240
5-chloro-N,N-diethyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 59828240) has the molecular formula C13H12ClF7N2O2 and a molecular weight of 396.69 g/mol. Its IUPAC name is 5-chloro-N,N-diethyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-chloro-N,N-diethyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59828240 |
| Molecular Formula | C13H12ClF7N2O2 |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 5-chloro-N,N-diethyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(Cl)c(C(F)(F)C(F)(F)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C13H12ClF7N2O2/c1-3-23(4-2)10(25)6-5-7(14)8(22-9(6)24)11(15,16)12(17,18)13(19,20)21/h5H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | QCGZKWNSOUBPGL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|