C9H8F4N2O2 — CID 59828241
N-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide (PubChem CID 59828241) has the molecular formula C9H8F4N2O2 and a molecular weight of 252.17 g/mol. Its IUPAC name is N-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59828241 |
| Molecular Formula | C9H8F4N2O2 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-methyl-2-oxo-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(C(F)(F)C(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H8F4N2O2/c1-14-6(16)4-2-3-5(15-7(4)17)9(12,13)8(10)11/h2-3,8H,1H3,(H,14,16)(H,15,17) |
| InChIKey | SVGHZPMWNQQISF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|