C8H4F6N2O2 — CID 11065630
2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 11065630) has the molecular formula C8H4F6N2O2 and a molecular weight of 274.12 g/mol. Its IUPAC name is 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11065630 |
| Molecular Formula | C8H4F6N2O2 |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(C(F)(F)F)cc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C8H4F6N2O2/c9-7(10,11)2-1-3(8(12,13)14)16-6(18)4(2)5(15)17/h1H,(H2,15,17)(H,16,18) |
| InChIKey | GPIUOOHEYPTBEI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |