C8H7F3N2O2 — CID 14043512
4-methyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 14043512) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is 4-methyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 4-methyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 14043512 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-methyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)[nH]c(=O)c1C(N)=O |
| InChI | InChI=1S/C8H7F3N2O2/c1-3-2-4(8(9,10)11)13-7(15)5(3)6(12)14/h2H,1H3,(H2,12,14)(H,13,15) |
| InChIKey | ISPYTJOFALZLCQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |