C8H8F3NO — CID 18723546
5,6-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 18723546) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is 5,6-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 5,6-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 18723546 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 5,6-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(C(F)(F)F)c(=O)[nH]c1C |
| InChI | InChI=1S/C8H8F3NO/c1-4-3-6(8(9,10)11)7(13)12-5(4)2/h3H,1-2H3,(H,12,13) |
| InChIKey | HAVBLSXKVVBKJX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |