C12H11F7N2O2 — CID 59828242
6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide (PubChem CID 59828242) has the molecular formula C12H11F7N2O2 and a molecular weight of 348.22 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide.
| Compound Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59828242 |
| Molecular Formula | C12H11F7N2O2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-2-oxo-N-propyl-1H-pyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1ccc(C(F)(F)C(F)(F)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C12H11F7N2O2/c1-2-5-20-8(22)6-3-4-7(21-9(6)23)10(13,14)11(15,16)12(17,18)19/h3-4H,2,5H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | FRKXMHZZEYHCGZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|